C18H12Cl2F3N5O — CID 138567565
5-[(2,4-dichlorophenyl)iminomethyl]-4-N-[4-(trifluoromethoxy)phenyl]pyrimidine-4,6-diamine (PubChem CID 138567565) has the molecular formula C18H12Cl2F3N5O and a molecular weight of 442.23 g/mol. Its IUPAC name is 5-[(2,4-dichlorophenyl)iminomethyl]-4-N-[4-(trifluoromethoxy)phenyl]pyrimidine-4,6-diamine.
| Compound Name | 5-[(2,4-dichlorophenyl)iminomethyl]-4-N-[4-(trifluoromethoxy)phenyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 138567565 |
| Molecular Formula | C18H12Cl2F3N5O |
| Molecular Weight | 442.23 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 5-[(2,4-dichlorophenyl)iminomethyl]-4-N-[4-(trifluoromethoxy)phenyl]pyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(Nc2ccc(OC(F)(F)F)cc2)c1/C=N/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H12Cl2F3N5O/c19-10-1-6-15(14(20)7-10)25-8-13-16(24)26-9-27-17(13)28-11-2-4-12(5-3-11)29-18(21,22)23/h1-9H,(H3,24,26,27,28)/b25-8+ |
| InChIKey | FUHRZQFPZOXATQ-ZNLRHDTNSA-N |
| XLogP | 5.76 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.23 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|