About (Z)-7-fluoro-1-N',5-dimethyloct-4-ene-1,1-diamine
(Z)-7-fluoro-1-N',5-dimethyloct-4-ene-1,1-diamine (PubChem CID 138567970) has the molecular formula C10H21FN2
and a molecular weight of 188.29 g/mol. Its IUPAC name is (Z)-7-fluoro-1-N',5-dimethyloct-4-ene-1,1-diamine.
Molecular Properties
| Compound Name | (Z)-7-fluoro-1-N',5-dimethyloct-4-ene-1,1-diamine |
| PubChem CID | 138567970 |
| Molecular Formula | C10H21FN2 |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.17 |
| IUPAC Name | (Z)-7-fluoro-1-N',5-dimethyloct-4-ene-1,1-diamine |
| SMILES | CNC(N)CC/C=C(/C)CC(C)F |
| InChI | InChI=1S/C10H21FN2/c1-8(7-9(2)11)5-4-6-10(12)13-3/h5,9-10,13H,4,6-7,12H2,1-3H3/b8-5- |
| InChIKey | VRFAEYIVCWCKOX-YVMONPNESA-N |
| XLogP | 1.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-7-fluoro-1-N',5-dimethyloct-4-ene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-7-fluoro-1-N',5-dimethyloct-4-ene-1,1-diamine?
The IUPAC name of (Z)-7-fluoro-1-N',5-dimethyloct-4-ene-1,1-diamine (CID 138567970) is (Z)-7-fluoro-1-N',5-dimethyloct-4-ene-1,1-diamine.
What is the SMILES notation for (Z)-7-fluoro-1-N',5-dimethyloct-4-ene-1,1-diamine?
The canonical SMILES for (Z)-7-fluoro-1-N',5-dimethyloct-4-ene-1,1-diamine is CNC(N)CC/C=C(/C)CC(C)F.
What is the InChIKey of (Z)-7-fluoro-1-N',5-dimethyloct-4-ene-1,1-diamine?
The InChIKey is VRFAEYIVCWCKOX-YVMONPNESA-N. The full InChI is InChI=1S/C10H21FN2/c1-8(7-9(2)11)5-4-6-10(12)13-3/h5,9-10,13H,4,6-7,12H2,1-3H3/b8-5-.
What are the key properties of (Z)-7-fluoro-1-N',5-dimethyloct-4-ene-1,1-diamine?
(Z)-7-fluoro-1-N',5-dimethyloct-4-ene-1,1-diamine has a molecular weight of 188.29 g/mol, XLogP of 1.97, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-7-fluoro-1-N',5-dimethyloct-4-ene-1,1-diamine is sourced from PubChem (CID 138567970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).