C29H37NO4 — CID 138568131
methyl 11-cyano-2,2,6b,12a-tetramethyl-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,9,14a,14b-dodecahydropicene-4a-carboxylate (PubChem CID 138568131) has the molecular formula C29H37NO4 and a molecular weight of 463.62 g/mol. Its IUPAC name is methyl 11-cyano-2,2,6b,12a-tetramethyl-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,9,14a,14b-dodecahydropicene-4a-carboxylate.
| Compound Name | methyl 11-cyano-2,2,6b,12a-tetramethyl-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,9,14a,14b-dodecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 138568131 |
| Molecular Formula | C29H37NO4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | methyl 11-cyano-2,2,6b,12a-tetramethyl-10,14-dioxo-1,3,4,5,6,6a,7,8,8a,9,14a,14b-dodecahydropicene-4a-carboxylate |
| SMILES | COC(=O)C12CCC3C(C(=O)C=C4C5(C)C=C(C#N)C(=O)CC5CCC43C)C1CC(C)(C)CC2 |
| InChI | InChI=1S/C29H37NO4/c1-26(2)10-11-29(25(33)34-5)9-7-19-24(20(29)15-26)22(32)13-23-27(19,3)8-6-18-12-21(31)17(16-30)14-28(18,23)4/h13-14,18-20,24H,6-12,15H2,1-5H3 |
| InChIKey | YXAACWZKMKGMRP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |