C24H25ClN4O3S — CID 138569447
1-[2-chloro-4-[(E)-1-[2,2-dimethyl-7-(methylideneamino)-4-oxo-3H-1,3-benzoxazin-6-yl]prop-1-enoxy]phenyl]-3-cyclopropylthiourea (PubChem CID 138569447) has the molecular formula C24H25ClN4O3S and a molecular weight of 485.01 g/mol. Its IUPAC name is 1-[2-chloro-4-[(E)-1-[2,2-dimethyl-7-(methylideneamino)-4-oxo-3H-1,3-benzoxazin-6-yl]prop-1-enoxy]phenyl]-3-cyclopropylthiourea.
| Compound Name | 1-[2-chloro-4-[(E)-1-[2,2-dimethyl-7-(methylideneamino)-4-oxo-3H-1,3-benzoxazin-6-yl]prop-1-enoxy]phenyl]-3-cyclopropylthiourea |
|---|---|
| PubChem CID | 138569447 |
| Molecular Formula | C24H25ClN4O3S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 1-[2-chloro-4-[(E)-1-[2,2-dimethyl-7-(methylideneamino)-4-oxo-3H-1,3-benzoxazin-6-yl]prop-1-enoxy]phenyl]-3-cyclopropylthiourea |
| SMILES | C=Nc1cc2c(cc1/C(=C\C)Oc1ccc(NC(=S)NC3CC3)c(Cl)c1)C(=O)NC(C)(C)O2 |
| InChI | InChI=1S/C24H25ClN4O3S/c1-5-20(15-11-16-21(12-19(15)26-4)32-24(2,3)29-22(16)30)31-14-8-9-18(17(25)10-14)28-23(33)27-13-6-7-13/h5,8-13H,4,6-7H2,1-3H3,(H,29,30)(H2,27,28,33)/b20-5+ |
| InChIKey | RKLXZJQMVNZUFF-DENHBWNVSA-N |
| XLogP | 5.42 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|