C23H16ClF3N4O6 — CID 138569509
4-[3-chloro-4-[[3,4-dioxo-2-(2,2,2-trifluoroethylamino)oxycyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carboxamide (PubChem CID 138569509) has the molecular formula C23H16ClF3N4O6 and a molecular weight of 536.85 g/mol. Its IUPAC name is 4-[3-chloro-4-[[3,4-dioxo-2-(2,2,2-trifluoroethylamino)oxycyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carboxamide.
| Compound Name | 4-[3-chloro-4-[[3,4-dioxo-2-(2,2,2-trifluoroethylamino)oxycyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 138569509 |
| Molecular Formula | C23H16ClF3N4O6 |
| Molecular Weight | 536.85 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | 4-[3-chloro-4-[[3,4-dioxo-2-(2,2,2-trifluoroethylamino)oxycyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(Nc4c(ONCC(F)(F)F)c(=O)c4=O)c(Cl)c3)c2cc1C(N)=O |
| InChI | InChI=1S/C23H16ClF3N4O6/c1-35-17-8-15-11(7-12(17)22(28)34)16(4-5-29-15)36-10-2-3-14(13(24)6-10)31-18-19(32)20(33)21(18)37-30-9-23(25,26)27/h2-8,30-31H,9H2,1H3,(H2,28,34) |
| InChIKey | NNJVGTFCJFUALY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 141.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.85 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|