C29H34FNO6S — CID 138569617
[(13S,17R)-13-ethyl-17-ethynyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] 2-(3-fluoro-4-sulfamoylphenoxy)acetate (PubChem CID 138569617) has the molecular formula C29H34FNO6S and a molecular weight of 543.66 g/mol. Its IUPAC name is [(13S,17R)-13-ethyl-17-ethynyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] 2-(3-fluoro-4-sulfamoylphenoxy)acetate.
| Compound Name | [(13S,17R)-13-ethyl-17-ethynyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] 2-(3-fluoro-4-sulfamoylphenoxy)acetate |
|---|---|
| PubChem CID | 138569617 |
| Molecular Formula | C29H34FNO6S |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | [(13S,17R)-13-ethyl-17-ethynyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] 2-(3-fluoro-4-sulfamoylphenoxy)acetate |
| SMILES | C#C[C@]1(OC(=O)COc2ccc(S(N)(=O)=O)c(F)c2)CCC2C3CCC4=CC(=O)CCC4C3CC[C@@]21CC |
| InChI | InChI=1S/C29H34FNO6S/c1-3-28-13-11-22-21-9-6-19(32)15-18(21)5-8-23(22)24(28)12-14-29(28,4-2)37-27(33)17-36-20-7-10-26(25(30)16-20)38(31,34)35/h2,7,10,15-16,21-24H,3,5-6,8-9,11-14,17H2,1H3,(H2,31,34,35)/t21?,22?,23?,24?,28-,29-/m0/s1 |
| InChIKey | KJWVSMSNLPBWAO-IIJVXSPASA-N |
| XLogP | 4.30 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|