About 2-(5-cyclopropyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine
2-(5-cyclopropyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 138570504) has the molecular formula C13H12N4S
and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-(5-cyclopropyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine.
Molecular Properties
| Compound Name | 2-(5-cyclopropyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine |
| PubChem CID | 138570504 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-(5-cyclopropyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | Nc1ccnc2[nH]c(-c3ncc(C4CC4)s3)cc12 |
| InChI | InChI=1S/C13H12N4S/c14-9-3-4-15-12-8(9)5-10(17-12)13-16-6-11(18-13)7-1-2-7/h3-7H,1-2H2,(H3,14,15,17) |
| InChIKey | AHTHWHAJMIMVNU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-cyclopropyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-cyclopropyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine?
The IUPAC name of 2-(5-cyclopropyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine (CID 138570504) is 2-(5-cyclopropyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine.
What is the SMILES notation for 2-(5-cyclopropyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine?
The canonical SMILES for 2-(5-cyclopropyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine is Nc1ccnc2[nH]c(-c3ncc(C4CC4)s3)cc12.
What is the InChIKey of 2-(5-cyclopropyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine?
The InChIKey is AHTHWHAJMIMVNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4S/c14-9-3-4-15-12-8(9)5-10(17-12)13-16-6-11(18-13)7-1-2-7/h3-7H,1-2H2,(H3,14,15,17).
What are the key properties of 2-(5-cyclopropyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine?
2-(5-cyclopropyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine has a molecular weight of 256.33 g/mol, XLogP of 3.15, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-cyclopropyl-1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine is sourced from PubChem (CID 138570504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).