About (3Z)-1,8-dimethyl-10-oxabicyclo[6.3.1]dodec-3-ene-9,11-dione
(3Z)-1,8-dimethyl-10-oxabicyclo[6.3.1]dodec-3-ene-9,11-dione (PubChem CID 138570930) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is (3Z)-1,8-dimethyl-10-oxabicyclo[6.3.1]dodec-3-ene-9,11-dione.
Molecular Properties
| Compound Name | (3Z)-1,8-dimethyl-10-oxabicyclo[6.3.1]dodec-3-ene-9,11-dione |
| PubChem CID | 138570930 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (3Z)-1,8-dimethyl-10-oxabicyclo[6.3.1]dodec-3-ene-9,11-dione |
| SMILES | CC12C/C=C\CCCC(C)(C1)C(=O)OC2=O |
| InChI | InChI=1S/C13H18O3/c1-12-7-5-3-4-6-8-13(2,9-12)11(15)16-10(12)14/h3,5H,4,6-9H2,1-2H3/b5-3- |
| InChIKey | KJEFFHMQAQJAPS-HYXAFXHYSA-N |
| XLogP | 2.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-1,8-dimethyl-10-oxabicyclo[6.3.1]dodec-3-ene-9,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-1,8-dimethyl-10-oxabicyclo[6.3.1]dodec-3-ene-9,11-dione?
The IUPAC name of (3Z)-1,8-dimethyl-10-oxabicyclo[6.3.1]dodec-3-ene-9,11-dione (CID 138570930) is (3Z)-1,8-dimethyl-10-oxabicyclo[6.3.1]dodec-3-ene-9,11-dione.
What is the SMILES notation for (3Z)-1,8-dimethyl-10-oxabicyclo[6.3.1]dodec-3-ene-9,11-dione?
The canonical SMILES for (3Z)-1,8-dimethyl-10-oxabicyclo[6.3.1]dodec-3-ene-9,11-dione is CC12C/C=C\CCCC(C)(C1)C(=O)OC2=O.
What is the InChIKey of (3Z)-1,8-dimethyl-10-oxabicyclo[6.3.1]dodec-3-ene-9,11-dione?
The InChIKey is KJEFFHMQAQJAPS-HYXAFXHYSA-N. The full InChI is InChI=1S/C13H18O3/c1-12-7-5-3-4-6-8-13(2,9-12)11(15)16-10(12)14/h3,5H,4,6-9H2,1-2H3/b5-3-.
What are the key properties of (3Z)-1,8-dimethyl-10-oxabicyclo[6.3.1]dodec-3-ene-9,11-dione?
(3Z)-1,8-dimethyl-10-oxabicyclo[6.3.1]dodec-3-ene-9,11-dione has a molecular weight of 222.28 g/mol, XLogP of 2.60, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-1,8-dimethyl-10-oxabicyclo[6.3.1]dodec-3-ene-9,11-dione is sourced from PubChem (CID 138570930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).