C7H16N2O3 — CID 138571231
(1S,2R,3S,4S,5R)-2,5-diamino-4-methoxycyclohexane-1,3-diol (PubChem CID 138571231) has the molecular formula C7H16N2O3 and a molecular weight of 176.22 g/mol. Its IUPAC name is (1S,2R,3S,4S,5R)-2,5-diamino-4-methoxycyclohexane-1,3-diol.
| Compound Name | (1S,2R,3S,4S,5R)-2,5-diamino-4-methoxycyclohexane-1,3-diol |
|---|---|
| PubChem CID | 138571231 |
| Molecular Formula | C7H16N2O3 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (1S,2R,3S,4S,5R)-2,5-diamino-4-methoxycyclohexane-1,3-diol |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](N)[C@@H](O)C[C@H]1N |
| InChI | InChI=1S/C7H16N2O3/c1-12-7-3(8)2-4(10)5(9)6(7)11/h3-7,10-11H,2,8-9H2,1H3/t3-,4+,5-,6+,7+/m1/s1 |
| InChIKey | VETWMFBSXAWJLV-UOYQFSTFSA-N |
| XLogP | -2.22 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |