About N-(2-ethenylfuro[3,2-b]pyridin-3-yl)ethanimine
N-(2-ethenylfuro[3,2-b]pyridin-3-yl)ethanimine (PubChem CID 138571539) has the molecular formula C11H10N2O
and a molecular weight of 186.21 g/mol. Its IUPAC name is N-(2-ethenylfuro[3,2-b]pyridin-3-yl)ethanimine.
Molecular Properties
| Compound Name | N-(2-ethenylfuro[3,2-b]pyridin-3-yl)ethanimine |
| PubChem CID | 138571539 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | N-(2-ethenylfuro[3,2-b]pyridin-3-yl)ethanimine |
| SMILES | C=Cc1oc2cccnc2c1/N=C/C |
| InChI | InChI=1S/C11H10N2O/c1-3-8-10(12-4-2)11-9(14-8)6-5-7-13-11/h3-7H,1H2,2H3/b12-4+ |
| InChIKey | ORTOUZCQBJNFGV-UUILKARUSA-N |
| XLogP | 3.19 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethenylfuro[3,2-b]pyridin-3-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethenylfuro[3,2-b]pyridin-3-yl)ethanimine?
The IUPAC name of N-(2-ethenylfuro[3,2-b]pyridin-3-yl)ethanimine (CID 138571539) is N-(2-ethenylfuro[3,2-b]pyridin-3-yl)ethanimine.
What is the SMILES notation for N-(2-ethenylfuro[3,2-b]pyridin-3-yl)ethanimine?
The canonical SMILES for N-(2-ethenylfuro[3,2-b]pyridin-3-yl)ethanimine is C=Cc1oc2cccnc2c1/N=C/C.
What is the InChIKey of N-(2-ethenylfuro[3,2-b]pyridin-3-yl)ethanimine?
The InChIKey is ORTOUZCQBJNFGV-UUILKARUSA-N. The full InChI is InChI=1S/C11H10N2O/c1-3-8-10(12-4-2)11-9(14-8)6-5-7-13-11/h3-7H,1H2,2H3/b12-4+.
What are the key properties of N-(2-ethenylfuro[3,2-b]pyridin-3-yl)ethanimine?
N-(2-ethenylfuro[3,2-b]pyridin-3-yl)ethanimine has a molecular weight of 186.21 g/mol, XLogP of 3.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethenylfuro[3,2-b]pyridin-3-yl)ethanimine is sourced from PubChem (CID 138571539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).