C19H28O2S — CID 138572000
S-[2-(4-methoxyphenyl)ethyl] 2,2,6-trimethylcyclohexane-1-carbothioate (PubChem CID 138572000) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is S-[2-(4-methoxyphenyl)ethyl] 2,2,6-trimethylcyclohexane-1-carbothioate.
| Compound Name | S-[2-(4-methoxyphenyl)ethyl] 2,2,6-trimethylcyclohexane-1-carbothioate |
|---|---|
| PubChem CID | 138572000 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | S-[2-(4-methoxyphenyl)ethyl] 2,2,6-trimethylcyclohexane-1-carbothioate |
| SMILES | COc1ccc(CCSC(=O)C2C(C)CCCC2(C)C)cc1 |
| InChI | InChI=1S/C19H28O2S/c1-14-6-5-12-19(2,3)17(14)18(20)22-13-11-15-7-9-16(21-4)10-8-15/h7-10,14,17H,5-6,11-13H2,1-4H3 |
| InChIKey | QXJGKJYVEAZZOW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|