C16H16F2INO4 — CID 138572671
(4S)-3-[(5R)-5-(2,4-difluorophenyl)-5-(iodomethyl)oxolane-3-carbonyl]-4-methyl-1,3-oxazolidin-2-one (PubChem CID 138572671) has the molecular formula C16H16F2INO4 and a molecular weight of 451.21 g/mol. Its IUPAC name is (4S)-3-[(5R)-5-(2,4-difluorophenyl)-5-(iodomethyl)oxolane-3-carbonyl]-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(5R)-5-(2,4-difluorophenyl)-5-(iodomethyl)oxolane-3-carbonyl]-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 138572671 |
| Molecular Formula | C16H16F2INO4 |
| Molecular Weight | 451.21 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | (4S)-3-[(5R)-5-(2,4-difluorophenyl)-5-(iodomethyl)oxolane-3-carbonyl]-4-methyl-1,3-oxazolidin-2-one |
| SMILES | C[C@H]1COC(=O)N1C(=O)C1CO[C@@](CI)(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C16H16F2INO4/c1-9-6-23-15(22)20(9)14(21)10-5-16(8-19,24-7-10)12-3-2-11(17)4-13(12)18/h2-4,9-10H,5-8H2,1H3/t9-,10?,16-/m0/s1 |
| InChIKey | KVCPIPBKLBHVME-PERISYRUSA-N |
| XLogP | 3.00 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.21 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|