About 2-ethyl-N,6,6-trimethylazepin-3-amine
2-ethyl-N,6,6-trimethylazepin-3-amine (PubChem CID 138573251) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 2-ethyl-N,6,6-trimethylazepin-3-amine.
Molecular Properties
| Compound Name | 2-ethyl-N,6,6-trimethylazepin-3-amine |
| PubChem CID | 138573251 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2-ethyl-N,6,6-trimethylazepin-3-amine |
| SMILES | CCC1=C(NC)C=CC(C)(C)C=N1 |
| InChI | InChI=1S/C11H18N2/c1-5-9-10(12-4)6-7-11(2,3)8-13-9/h6-8,12H,5H2,1-4H3 |
| InChIKey | MKRTUUQFZULVJS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-N,6,6-trimethylazepin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N,6,6-trimethylazepin-3-amine?
The IUPAC name of 2-ethyl-N,6,6-trimethylazepin-3-amine (CID 138573251) is 2-ethyl-N,6,6-trimethylazepin-3-amine.
What is the SMILES notation for 2-ethyl-N,6,6-trimethylazepin-3-amine?
The canonical SMILES for 2-ethyl-N,6,6-trimethylazepin-3-amine is CCC1=C(NC)C=CC(C)(C)C=N1.
What is the InChIKey of 2-ethyl-N,6,6-trimethylazepin-3-amine?
The InChIKey is MKRTUUQFZULVJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-5-9-10(12-4)6-7-11(2,3)8-13-9/h6-8,12H,5H2,1-4H3.
What are the key properties of 2-ethyl-N,6,6-trimethylazepin-3-amine?
2-ethyl-N,6,6-trimethylazepin-3-amine has a molecular weight of 178.28 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N,6,6-trimethylazepin-3-amine is sourced from PubChem (CID 138573251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).