C58H38N4O2 — CID 138573539
3-[3-[4-[2-(10,10-diphenyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20),16,18-nonaen-18-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]aniline (PubChem CID 138573539) has the molecular formula C58H38N4O2 and a molecular weight of 822.97 g/mol. Its IUPAC name is 3-[3-[4-[2-(10,10-diphenyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20),16,18-nonaen-18-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]aniline.
| Compound Name | 3-[3-[4-[2-(10,10-diphenyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20),16,18-nonaen-18-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]aniline |
|---|---|
| PubChem CID | 138573539 |
| Molecular Formula | C58H38N4O2 |
| Molecular Weight | 822.97 g/mol |
| Exact Mass | 822.30 |
| IUPAC Name | 3-[3-[4-[2-(10,10-diphenyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20),16,18-nonaen-18-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]aniline |
| SMILES | Nc1cccc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4-c4ccc5c(c4)Oc4cc6c(cc4O5)C(c4ccccc4)(c4ccccc4)c4ccccc4-6)n3)c2)c1 |
| InChI | InChI=1S/C58H38N4O2/c59-44-25-15-19-39(33-44)38-18-14-20-41(32-38)56-60-55(37-16-4-1-5-17-37)61-57(62-56)47-28-11-10-26-45(47)40-30-31-51-52(34-40)64-53-35-48-46-27-12-13-29-49(46)58(42-21-6-2-7-22-42,43-23-8-3-9-24-43)50(48)36-54(53)63-51/h1-36H,59H2 |
| InChIKey | TWROGUZYTGZTMV-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.97 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|