C36H25N3O2 — CID 138573631
2-(10,10-dimethyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20),16,18-nonaen-18-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 138573631) has the molecular formula C36H25N3O2 and a molecular weight of 531.62 g/mol. Its IUPAC name is 2-(10,10-dimethyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20),16,18-nonaen-18-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(10,10-dimethyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20),16,18-nonaen-18-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 138573631 |
| Molecular Formula | C36H25N3O2 |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 2-(10,10-dimethyl-14,21-dioxapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20),16,18-nonaen-18-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2cc3c(cc21)Oc1ccc(-c2nc(-c4ccccc4)nc(-c4ccccc4)n2)cc1O3 |
| InChI | InChI=1S/C36H25N3O2/c1-36(2)27-16-10-9-15-25(27)26-20-31-32(21-28(26)36)40-29-18-17-24(19-30(29)41-31)35-38-33(22-11-5-3-6-12-22)37-34(39-35)23-13-7-4-8-14-23/h3-21H,1-2H3 |
| InChIKey | HQTQFGKYMUPXOZ-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |