C26H26N4O4 — CID 138574795
2-(2,6-dioxopiperidin-3-yl)-4-[2-[1-[(6-ethenyl-3-pyridinyl)methyl]azetidin-3-yl]ethyl]isoindole-1,3-dione (PubChem CID 138574795) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[2-[1-[(6-ethenyl-3-pyridinyl)methyl]azetidin-3-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[1-[(6-ethenyl-3-pyridinyl)methyl]azetidin-3-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 138574795 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[1-[(6-ethenyl-3-pyridinyl)methyl]azetidin-3-yl]ethyl]isoindole-1,3-dione |
| SMILES | C=Cc1ccc(CN2CC(CCc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)C2)cn1 |
| InChI | InChI=1S/C26H26N4O4/c1-2-19-9-7-16(12-27-19)13-29-14-17(15-29)6-8-18-4-3-5-20-23(18)26(34)30(25(20)33)21-10-11-22(31)28-24(21)32/h2-5,7,9,12,17,21H,1,6,8,10-11,13-15H2,(H,28,31,32) |
| InChIKey | RITYNYYHTFMTLS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|