C42H29N3O2 — CID 138576199
2-[4-(8,8-dimethylindeno[1,2-a]oxanthren-4-yl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 138576199) has the molecular formula C42H29N3O2 and a molecular weight of 607.71 g/mol. Its IUPAC name is 2-[4-(8,8-dimethylindeno[1,2-a]oxanthren-4-yl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-(8,8-dimethylindeno[1,2-a]oxanthren-4-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 138576199 |
| Molecular Formula | C42H29N3O2 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.23 |
| IUPAC Name | 2-[4-(8,8-dimethylindeno[1,2-a]oxanthren-4-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2c1ccc1c2Oc2cccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)c2O1 |
| InChI | InChI=1S/C42H29N3O2/c1-42(2)32-18-10-9-16-31(32)36-33(42)24-25-35-38(36)47-34-19-11-17-30(37(34)46-35)26-20-22-29(23-21-26)41-44-39(27-12-5-3-6-13-27)43-40(45-41)28-14-7-4-8-15-28/h3-25H,1-2H3 |
| InChIKey | MUQKPQQMJUCQHK-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |