About 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine
6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine (PubChem CID 138576345) has the molecular formula C7H9BrN4
and a molecular weight of 229.08 g/mol. Its IUPAC name is 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine |
| PubChem CID | 138576345 |
| Molecular Formula | C7H9BrN4 |
| Molecular Weight | 229.08 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CC1=CNC2C(N)=NC(Br)=CN12 |
| InChI | InChI=1S/C7H9BrN4/c1-4-2-10-7-6(9)11-5(8)3-12(4)7/h2-3,7,10H,1H3,(H2,9,11) |
| InChIKey | RVCMBLXGZNRUFR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.08 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine?
The IUPAC name of 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine (CID 138576345) is 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine.
What is the SMILES notation for 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine?
The canonical SMILES for 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine is CC1=CNC2C(N)=NC(Br)=CN12.
What is the InChIKey of 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine?
The InChIKey is RVCMBLXGZNRUFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN4/c1-4-2-10-7-6(9)11-5(8)3-12(4)7/h2-3,7,10H,1H3,(H2,9,11).
What are the key properties of 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine?
6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine has a molecular weight of 229.08 g/mol, XLogP of 0.64, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine is sourced from PubChem (CID 138576345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).