C26H35F2N7O2 — CID 138576609
2-[(3E)-2-cyano-3-(3,3-difluoropiperidin-4-yl)oxyhexa-3,5-dien-2-yl]-1-[6-methoxy-5-(1-methylpiperidin-4-yl)-2-pyridinyl]-3-methylideneguanidine (PubChem CID 138576609) has the molecular formula C26H35F2N7O2 and a molecular weight of 515.61 g/mol. Its IUPAC name is 2-[(3E)-2-cyano-3-(3,3-difluoropiperidin-4-yl)oxyhexa-3,5-dien-2-yl]-1-[6-methoxy-5-(1-methylpiperidin-4-yl)-2-pyridinyl]-3-methylideneguanidine.
| Compound Name | 2-[(3E)-2-cyano-3-(3,3-difluoropiperidin-4-yl)oxyhexa-3,5-dien-2-yl]-1-[6-methoxy-5-(1-methylpiperidin-4-yl)-2-pyridinyl]-3-methylideneguanidine |
|---|---|
| PubChem CID | 138576609 |
| Molecular Formula | C26H35F2N7O2 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | 2-[(3E)-2-cyano-3-(3,3-difluoropiperidin-4-yl)oxyhexa-3,5-dien-2-yl]-1-[6-methoxy-5-(1-methylpiperidin-4-yl)-2-pyridinyl]-3-methylideneguanidine |
| SMILES | C=C/C=C(/OC1CCNCC1(F)F)C(C)(C#N)/N=C(/N=C)Nc1ccc(C2CCN(C)CC2)c(OC)n1 |
| InChI | InChI=1S/C26H35F2N7O2/c1-6-7-20(37-21-10-13-31-17-26(21,27)28)25(2,16-29)34-24(30-3)33-22-9-8-19(23(32-22)36-5)18-11-14-35(4)15-12-18/h6-9,18,21,31H,1,3,10-15,17H2,2,4-5H3,(H,32,33,34)/b20-7+ |
| InChIKey | IYCUAYCAXBHEKS-IFRROFPPSA-N |
| XLogP | 3.73 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|