About 2-methyl-N-[7-(1,6-naphthyridin-4-yl)spiro[3.5]nonan-2-yl]propane-2-sulfinamide
2-methyl-N-[7-(1,6-naphthyridin-4-yl)spiro[3.5]nonan-2-yl]propane-2-sulfinamide (PubChem CID 138577067) has the molecular formula C21H29N3OS
and a molecular weight of 371.55 g/mol. Its IUPAC name is 2-methyl-N-[7-(1,6-naphthyridin-4-yl)spiro[3.5]nonan-2-yl]propane-2-sulfinamide.
Molecular Properties
| Compound Name | 2-methyl-N-[7-(1,6-naphthyridin-4-yl)spiro[3.5]nonan-2-yl]propane-2-sulfinamide |
| PubChem CID | 138577067 |
| Molecular Formula | C21H29N3OS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 2-methyl-N-[7-(1,6-naphthyridin-4-yl)spiro[3.5]nonan-2-yl]propane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)NC1CC2(CCC(c3ccnc4ccncc34)CC2)C1 |
| InChI | InChI=1S/C21H29N3OS/c1-20(2,3)26(25)24-16-12-21(13-16)8-4-15(5-9-21)17-6-11-23-19-7-10-22-14-18(17)19/h6-7,10-11,14-16,24H,4-5,8-9,12-13H2,1-3H3 |
| InChIKey | FMCQEBVHBVEVRA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-N-[7-(1,6-naphthyridin-4-yl)spiro[3.5]nonan-2-yl]propane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[7-(1,6-naphthyridin-4-yl)spiro[3.5]nonan-2-yl]propane-2-sulfinamide?
The IUPAC name of 2-methyl-N-[7-(1,6-naphthyridin-4-yl)spiro[3.5]nonan-2-yl]propane-2-sulfinamide (CID 138577067) is 2-methyl-N-[7-(1,6-naphthyridin-4-yl)spiro[3.5]nonan-2-yl]propane-2-sulfinamide.
What is the SMILES notation for 2-methyl-N-[7-(1,6-naphthyridin-4-yl)spiro[3.5]nonan-2-yl]propane-2-sulfinamide?
The canonical SMILES for 2-methyl-N-[7-(1,6-naphthyridin-4-yl)spiro[3.5]nonan-2-yl]propane-2-sulfinamide is CC(C)(C)S(=O)NC1CC2(CCC(c3ccnc4ccncc34)CC2)C1.
What is the InChIKey of 2-methyl-N-[7-(1,6-naphthyridin-4-yl)spiro[3.5]nonan-2-yl]propane-2-sulfinamide?
The InChIKey is FMCQEBVHBVEVRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29N3OS/c1-20(2,3)26(25)24-16-12-21(13-16)8-4-15(5-9-21)17-6-11-23-19-7-10-22-14-18(17)19/h6-7,10-11,14-16,24H,4-5,8-9,12-13H2,1-3H3.
What are the key properties of 2-methyl-N-[7-(1,6-naphthyridin-4-yl)spiro[3.5]nonan-2-yl]propane-2-sulfinamide?
2-methyl-N-[7-(1,6-naphthyridin-4-yl)spiro[3.5]nonan-2-yl]propane-2-sulfinamide has a molecular weight of 371.55 g/mol, XLogP of 4.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[7-(1,6-naphthyridin-4-yl)spiro[3.5]nonan-2-yl]propane-2-sulfinamide is sourced from PubChem (CID 138577067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).