C21H30FNO2 — CID 138577127
methyl 6-[(Z)-4-fluoro-1-[(3Z)-penta-1,3-dien-2-yl]iminopent-2-en-3-yl]-2-methylspiro[2.5]octane-2-carboxylate (PubChem CID 138577127) has the molecular formula C21H30FNO2 and a molecular weight of 347.47 g/mol. Its IUPAC name is methyl 6-[(Z)-4-fluoro-1-[(3Z)-penta-1,3-dien-2-yl]iminopent-2-en-3-yl]-2-methylspiro[2.5]octane-2-carboxylate.
| Compound Name | methyl 6-[(Z)-4-fluoro-1-[(3Z)-penta-1,3-dien-2-yl]iminopent-2-en-3-yl]-2-methylspiro[2.5]octane-2-carboxylate |
|---|---|
| PubChem CID | 138577127 |
| Molecular Formula | C21H30FNO2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | methyl 6-[(Z)-4-fluoro-1-[(3Z)-penta-1,3-dien-2-yl]iminopent-2-en-3-yl]-2-methylspiro[2.5]octane-2-carboxylate |
| SMILES | C=C(/C=C\C)/N=C/C=C(\C(C)F)C1CCC2(CC1)CC2(C)C(=O)OC |
| InChI | InChI=1S/C21H30FNO2/c1-6-7-15(2)23-13-10-18(16(3)22)17-8-11-21(12-9-17)14-20(21,4)19(24)25-5/h6-7,10,13,16-17H,2,8-9,11-12,14H2,1,3-5H3/b7-6-,18-10+,23-13+ |
| InChIKey | DKRCJJNUUPBVAY-ISTWTMKFSA-N |
| XLogP | 5.19 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|