C15H22FN3O3S — CID 138577361
(2R,3R,4R,6R)-4-[1-fluoroethyl-(methyldiazenyl)amino]-2-(hydroxymethyl)-6-phenylsulfanyloxan-3-ol (PubChem CID 138577361) has the molecular formula C15H22FN3O3S and a molecular weight of 343.42 g/mol. Its IUPAC name is (2R,3R,4R,6R)-4-[1-fluoroethyl-(methyldiazenyl)amino]-2-(hydroxymethyl)-6-phenylsulfanyloxan-3-ol.
| Compound Name | (2R,3R,4R,6R)-4-[1-fluoroethyl-(methyldiazenyl)amino]-2-(hydroxymethyl)-6-phenylsulfanyloxan-3-ol |
|---|---|
| PubChem CID | 138577361 |
| Molecular Formula | C15H22FN3O3S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (2R,3R,4R,6R)-4-[1-fluoroethyl-(methyldiazenyl)amino]-2-(hydroxymethyl)-6-phenylsulfanyloxan-3-ol |
| SMILES | C/N=N/N(C(C)F)[C@@H]1C[C@@H](Sc2ccccc2)O[C@H](CO)[C@@H]1O |
| InChI | InChI=1S/C15H22FN3O3S/c1-10(16)19(18-17-2)12-8-14(22-13(9-20)15(12)21)23-11-6-4-3-5-7-11/h3-7,10,12-15,20-21H,8-9H2,1-2H3/b18-17+/t10?,12-,13-,14-,15-/m1/s1 |
| InChIKey | WFYKYXWVQOTDMR-SJURNCFGSA-N |
| XLogP | 2.23 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|