C15H22N6O2S2 — CID 138577856
[1-[(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-1-oxopropan-2-yl] N,N'-diamino-N-cyclopropylcarbamimidothioate (PubChem CID 138577856) has the molecular formula C15H22N6O2S2 and a molecular weight of 382.52 g/mol. Its IUPAC name is [1-[(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-1-oxopropan-2-yl] N,N'-diamino-N-cyclopropylcarbamimidothioate.
| Compound Name | [1-[(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-1-oxopropan-2-yl] N,N'-diamino-N-cyclopropylcarbamimidothioate |
|---|---|
| PubChem CID | 138577856 |
| Molecular Formula | C15H22N6O2S2 |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [1-[(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-1-oxopropan-2-yl] N,N'-diamino-N-cyclopropylcarbamimidothioate |
| SMILES | CC(S/C(=N/N)N(N)C1CC1)C(=O)Nc1sc2c(c1C(N)=O)CCC2 |
| InChI | InChI=1S/C15H22N6O2S2/c1-7(24-15(20-17)21(18)8-5-6-8)13(23)19-14-11(12(16)22)9-3-2-4-10(9)25-14/h7-8H,2-6,17-18H2,1H3,(H2,16,22)(H,19,23)/b20-15+ |
| InChIKey | PZBYSCILJFKOOS-HMMYKYKNSA-N |
| XLogP | 0.96 |
| TPSA | 139.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|