About 1H-imidazo[1,2-c]pyrimidine-7-thione
1H-imidazo[1,2-c]pyrimidine-7-thione (PubChem CID 138577936) has the molecular formula C6H5N3S
and a molecular weight of 151.19 g/mol. Its IUPAC name is 1H-imidazo[1,2-c]pyrimidine-7-thione.
Molecular Properties
| Compound Name | 1H-imidazo[1,2-c]pyrimidine-7-thione |
| PubChem CID | 138577936 |
| Molecular Formula | C6H5N3S |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | 1H-imidazo[1,2-c]pyrimidine-7-thione |
| SMILES | S=c1cc2[nH]ccn2cn1 |
| InChI | InChI=1S/C6H5N3S/c10-6-3-5-7-1-2-9(5)4-8-6/h1-4,7H |
| InChIKey | JEJQRKPFMVFALL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazo[1,2-c]pyrimidine-7-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazo[1,2-c]pyrimidine-7-thione?
The IUPAC name of 1H-imidazo[1,2-c]pyrimidine-7-thione (CID 138577936) is 1H-imidazo[1,2-c]pyrimidine-7-thione.
What is the SMILES notation for 1H-imidazo[1,2-c]pyrimidine-7-thione?
The canonical SMILES for 1H-imidazo[1,2-c]pyrimidine-7-thione is S=c1cc2[nH]ccn2cn1.
What is the InChIKey of 1H-imidazo[1,2-c]pyrimidine-7-thione?
The InChIKey is JEJQRKPFMVFALL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3S/c10-6-3-5-7-1-2-9(5)4-8-6/h1-4,7H.
What are the key properties of 1H-imidazo[1,2-c]pyrimidine-7-thione?
1H-imidazo[1,2-c]pyrimidine-7-thione has a molecular weight of 151.19 g/mol, XLogP of 1.39, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazo[1,2-c]pyrimidine-7-thione is sourced from PubChem (CID 138577936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).