C24H23N5O2 — CID 138578013
(16Z)-11,20-dioxa-2,4,22,24,31-pentazapentacyclo[19.6.2.23,6.05,10.025,29]hentriaconta-1(28),3(31),4,6(30),7,9,16,21,23,25(29),26-undecaene (PubChem CID 138578013) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is (16Z)-11,20-dioxa-2,4,22,24,31-pentazapentacyclo[19.6.2.23,6.05,10.025,29]hentriaconta-1(28),3(31),4,6(30),7,9,16,21,23,25(29),26-undecaene.
| Compound Name | (16Z)-11,20-dioxa-2,4,22,24,31-pentazapentacyclo[19.6.2.23,6.05,10.025,29]hentriaconta-1(28),3(31),4,6(30),7,9,16,21,23,25(29),26-undecaene |
|---|---|
| PubChem CID | 138578013 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | (16Z)-11,20-dioxa-2,4,22,24,31-pentazapentacyclo[19.6.2.23,6.05,10.025,29]hentriaconta-1(28),3(31),4,6(30),7,9,16,21,23,25(29),26-undecaene |
| SMILES | C1=C\CCOc2ncnc3ccc(cc23)Nc2ncc3cccc(c3n2)OCCCC/1 |
| InChI | InChI=1S/C24H23N5O2/c1-2-4-6-13-31-23-19-14-18(10-11-20(19)26-16-27-23)28-24-25-15-17-8-7-9-21(22(17)29-24)30-12-5-3-1/h2,4,7-11,14-16H,1,3,5-6,12-13H2,(H,25,28,29)/b4-2- |
| InChIKey | VMZQZLFVCJQHEX-RQOWECAXSA-N |
| XLogP | 5.20 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|