2-(2,5-dioxopyrrol-1-yl)-3-(methylamino)propanoic acid

C8H10N2O4 — CID 138578026

IUPAC2-(2,5-dioxopyrrol-1-yl)-3-(methylamino)propanoic acid
SMILESCNCC(C(=O)O)N1C(=O)C=CC1=O
InChIInChI=1S/C8H10N2O4/c1-9-4-5(8(13)14)10-6(11)2-3-7(10)12/h2-3,5,9H,4H2,1H3,(H,13,14)
InChIKeyACIVBEPHYRJXBT-UHFFFAOYSA-N
MW198.18 g/mol
LogP-1.42
Rot. Bonds4

About 2-(2,5-dioxopyrrol-1-yl)-3-(methylamino)propanoic acid

2-(2,5-dioxopyrrol-1-yl)-3-(methylamino)propanoic acid (PubChem CID 138578026) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)-3-(methylamino)propanoic acid.

Molecular Properties

Compound Name2-(2,5-dioxopyrrol-1-yl)-3-(methylamino)propanoic acid
PubChem CID138578026
Molecular FormulaC8H10N2O4
Molecular Weight198.18 g/mol
Exact Mass198.06
IUPAC Name2-(2,5-dioxopyrrol-1-yl)-3-(methylamino)propanoic acid
SMILESCNCC(C(=O)O)N1C(=O)C=CC1=O
InChIInChI=1S/C8H10N2O4/c1-9-4-5(8(13)14)10-6(11)2-3-7(10)12/h2-3,5,9H,4H2,1H3,(H,13,14)
InChIKeyACIVBEPHYRJXBT-UHFFFAOYSA-N
XLogP-1.42
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.18
LogP ≤ 5-1.42
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-(2,5-dioxopyrrol-1-yl)-3-(methylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-dioxopyrrol-1-yl)-3-(methylamino)propanoic acid?
The IUPAC name of 2-(2,5-dioxopyrrol-1-yl)-3-(methylamino)propanoic acid (CID 138578026) is 2-(2,5-dioxopyrrol-1-yl)-3-(methylamino)propanoic acid.
What is the SMILES notation for 2-(2,5-dioxopyrrol-1-yl)-3-(methylamino)propanoic acid?
The canonical SMILES for 2-(2,5-dioxopyrrol-1-yl)-3-(methylamino)propanoic acid is CNCC(C(=O)O)N1C(=O)C=CC1=O.
What is the InChIKey of 2-(2,5-dioxopyrrol-1-yl)-3-(methylamino)propanoic acid?
The InChIKey is ACIVBEPHYRJXBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4/c1-9-4-5(8(13)14)10-6(11)2-3-7(10)12/h2-3,5,9H,4H2,1H3,(H,13,14).
What are the key properties of 2-(2,5-dioxopyrrol-1-yl)-3-(methylamino)propanoic acid?
2-(2,5-dioxopyrrol-1-yl)-3-(methylamino)propanoic acid has a molecular weight of 198.18 g/mol, XLogP of -1.42, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxopyrrol-1-yl)-3-(methylamino)propanoic acid is sourced from PubChem (CID 138578026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).