C23H30N4O — CID 138578253
(3aR,6aS)-2-(oxan-4-ylmethyl)-N-(6-phenylpyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 138578253) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is (3aR,6aS)-2-(oxan-4-ylmethyl)-N-(6-phenylpyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aR,6aS)-2-(oxan-4-ylmethyl)-N-(6-phenylpyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 138578253 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (3aR,6aS)-2-(oxan-4-ylmethyl)-N-(6-phenylpyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | c1ccc(-c2ccc(NC3C[C@@H]4CN(CC5CCOCC5)C[C@@H]4C3)nn2)cc1 |
| InChI | InChI=1S/C23H30N4O/c1-2-4-18(5-3-1)22-6-7-23(26-25-22)24-21-12-19-15-27(16-20(19)13-21)14-17-8-10-28-11-9-17/h1-7,17,19-21H,8-16H2,(H,24,26)/t19-,20+,21? |
| InChIKey | LNJNVHASYGIIGW-WCRBZPEASA-N |
| XLogP | 3.69 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |