C19H34N2 — CID 138578286
(3aR,6aS)-2-[(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 138578286) has the molecular formula C19H34N2 and a molecular weight of 290.49 g/mol. Its IUPAC name is (3aR,6aS)-2-[(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aR,6aS)-2-[(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 138578286 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | (3aR,6aS)-2-[(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | CC1CC2CC(C)CC(CN3C[C@H]4CC(N)C[C@H]4C3)(C1)C2 |
| InChI | InChI=1S/C19H34N2/c1-13-3-15-4-14(2)8-19(7-13,9-15)12-21-10-16-5-18(20)6-17(16)11-21/h13-18H,3-12,20H2,1-2H3/t13?,14?,15?,16-,17+,18?,19? |
| InChIKey | IDRNAJZHPFQLFJ-YFEGBAJISA-N |
| XLogP | 3.51 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |