C23H28ClFN4O — CID 138578326
(3aS,6aR)-N-[6-(2-chloro-5-fluorophenyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 138578326) has the molecular formula C23H28ClFN4O and a molecular weight of 430.96 g/mol. Its IUPAC name is (3aS,6aR)-N-[6-(2-chloro-5-fluorophenyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aS,6aR)-N-[6-(2-chloro-5-fluorophenyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 138578326 |
| Molecular Formula | C23H28ClFN4O |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | (3aS,6aR)-N-[6-(2-chloro-5-fluorophenyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | Fc1ccc(Cl)c(-c2ccc(NC3C[C@@H]4CN(CC5CCOCC5)C[C@@H]4C3)nn2)c1 |
| InChI | InChI=1S/C23H28ClFN4O/c24-21-2-1-18(25)11-20(21)22-3-4-23(28-27-22)26-19-9-16-13-29(14-17(16)10-19)12-15-5-7-30-8-6-15/h1-4,11,15-17,19H,5-10,12-14H2,(H,26,28)/t16-,17+,19? |
| InChIKey | XHKPKSGPVFYQNR-JJTKIYQPSA-N |
| XLogP | 4.49 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |