C23H29FN4O — CID 138578683
(3aS,6aR)-N-[6-(2-fluorophenyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 138578683) has the molecular formula C23H29FN4O and a molecular weight of 396.51 g/mol. Its IUPAC name is (3aS,6aR)-N-[6-(2-fluorophenyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aS,6aR)-N-[6-(2-fluorophenyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 138578683 |
| Molecular Formula | C23H29FN4O |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (3aS,6aR)-N-[6-(2-fluorophenyl)pyridazin-3-yl]-2-(oxan-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | Fc1ccccc1-c1ccc(NC2C[C@@H]3CN(CC4CCOCC4)C[C@@H]3C2)nn1 |
| InChI | InChI=1S/C23H29FN4O/c24-21-4-2-1-3-20(21)22-5-6-23(27-26-22)25-19-11-17-14-28(15-18(17)12-19)13-16-7-9-29-10-8-16/h1-6,16-19H,7-15H2,(H,25,27)/t17-,18+,19? |
| InChIKey | RKHGQLCCNBYMJX-DFNIBXOVSA-N |
| XLogP | 3.83 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |