About 2-(3,3-dimethyl-2-oxobutyl)-1,2-benzothiazol-3-one
2-(3,3-dimethyl-2-oxobutyl)-1,2-benzothiazol-3-one (PubChem CID 138578978) has the molecular formula C13H15NO2S
and a molecular weight of 249.34 g/mol. Its IUPAC name is 2-(3,3-dimethyl-2-oxobutyl)-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 2-(3,3-dimethyl-2-oxobutyl)-1,2-benzothiazol-3-one |
| PubChem CID | 138578978 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2-(3,3-dimethyl-2-oxobutyl)-1,2-benzothiazol-3-one |
| SMILES | CC(C)(C)C(=O)Cn1sc2ccccc2c1=O |
| InChI | InChI=1S/C13H15NO2S/c1-13(2,3)11(15)8-14-12(16)9-6-4-5-7-10(9)17-14/h4-7H,8H2,1-3H3 |
| InChIKey | LLWZTKDWUJNSSP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,3-dimethyl-2-oxobutyl)-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethyl-2-oxobutyl)-1,2-benzothiazol-3-one?
The IUPAC name of 2-(3,3-dimethyl-2-oxobutyl)-1,2-benzothiazol-3-one (CID 138578978) is 2-(3,3-dimethyl-2-oxobutyl)-1,2-benzothiazol-3-one.
What is the SMILES notation for 2-(3,3-dimethyl-2-oxobutyl)-1,2-benzothiazol-3-one?
The canonical SMILES for 2-(3,3-dimethyl-2-oxobutyl)-1,2-benzothiazol-3-one is CC(C)(C)C(=O)Cn1sc2ccccc2c1=O.
What is the InChIKey of 2-(3,3-dimethyl-2-oxobutyl)-1,2-benzothiazol-3-one?
The InChIKey is LLWZTKDWUJNSSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2S/c1-13(2,3)11(15)8-14-12(16)9-6-4-5-7-10(9)17-14/h4-7H,8H2,1-3H3.
What are the key properties of 2-(3,3-dimethyl-2-oxobutyl)-1,2-benzothiazol-3-one?
2-(3,3-dimethyl-2-oxobutyl)-1,2-benzothiazol-3-one has a molecular weight of 249.34 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethyl-2-oxobutyl)-1,2-benzothiazol-3-one is sourced from PubChem (CID 138578978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).