About CID 138579741
CID 138579741 (PubChem CID 138579741) has the molecular formula C54H24F9N7
and a molecular weight of 941.82 g/mol.
Molecular Properties
| Compound Name | CID 138579741 |
| PubChem CID | 138579741 |
| Molecular Formula | C54H24F9N7 |
| Molecular Weight | 941.82 g/mol |
| Exact Mass | 941.19 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1cnc2c(c1)-c1cccnc1C21c2cccc3c2N2c4c1cccc4C1(c4cccc(c42)C32c3ncccc3-c3cc(C(F)(F)F)cnc32)c2ncccc2-c2cc(C(F)(F)F)cnc21 |
| InChI | InChI=1S/C54H24F9N7/c55-52(56,57)25-19-31-28-7-4-16-64-43(28)49(46(31)67-22-25)34-10-1-11-35-40(34)70-41-36(49)12-2-14-38(41)51(45-30(9-6-18-66-45)33-21-27(54(61,62)63)24-69-48(33)51)39-15-3-13-37(42(39)70)50(35)44-29(8-5-17-65-44)32-20-26(53(58,59)60)23-68-47(32)50/h1-24H |
| InChIKey | JOGYWFWYRMZZSU-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 80.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 70 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 941.82 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 138579741 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 138579741?
The IUPAC name of CID 138579741 (CID 138579741) is not available.
What is the SMILES notation for CID 138579741?
The canonical SMILES for CID 138579741 is FC(F)(F)c1cnc2c(c1)-c1cccnc1C21c2cccc3c2N2c4c1cccc4C1(c4cccc(c42)C32c3ncccc3-c3cc(C(F)(F)F)cnc32)c2ncccc2-c2cc(C(F)(F)F)cnc21.
What is the InChIKey of CID 138579741?
The InChIKey is JOGYWFWYRMZZSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C54H24F9N7/c55-52(56,57)25-19-31-28-7-4-16-64-43(28)49(46(31)67-22-25)34-10-1-11-35-40(34)70-41-36(49)12-2-14-38(41)51(45-30(9-6-18-66-45)33-21-27(54(61,62)63)24-69-48(33)51)39-15-3-13-37(42(39)70)50(35)44-29(8-5-17-65-44)32-20-26(53(58,59)60)23-68-47(32)50/h1-24H.
What are the key properties of CID 138579741?
CID 138579741 has a molecular weight of 941.82 g/mol, XLogP of 12.61, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 138579741 is sourced from PubChem (CID 138579741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).