C23H32F3N6P — CID 138579975
4-N-[(1R)-1-cyclopropylethyl]-2-N-[3-(phosphanylmethyl)oct-7-en-2-yl]-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine (PubChem CID 138579975) has the molecular formula C23H32F3N6P and a molecular weight of 480.52 g/mol. Its IUPAC name is 4-N-[(1R)-1-cyclopropylethyl]-2-N-[3-(phosphanylmethyl)oct-7-en-2-yl]-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[(1R)-1-cyclopropylethyl]-2-N-[3-(phosphanylmethyl)oct-7-en-2-yl]-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 138579975 |
| Molecular Formula | C23H32F3N6P |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 4-N-[(1R)-1-cyclopropylethyl]-2-N-[3-(phosphanylmethyl)oct-7-en-2-yl]-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCCCC(CP)C(C)Nc1nc(N[C@H](C)C2CC2)nc(-c2cccc(C(F)(F)F)n2)n1 |
| InChI | InChI=1S/C23H32F3N6P/c1-4-5-6-8-17(13-33)15(3)28-22-31-20(18-9-7-10-19(29-18)23(24,25)26)30-21(32-22)27-14(2)16-11-12-16/h4,7,9-10,14-17H,1,5-6,8,11-13,33H2,2-3H3,(H2,27,28,30,31,32)/t14-,15?,17?/m1/s1 |
| InChIKey | QCFBHPCUDUOHRE-HPUBIQBYSA-N |
| XLogP | 5.81 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|