C14H25F4N5 — CID 138579998
1-[amino-[(4,4-difluorocyclohexyl)amino]methyl]-2-(4,4-difluorocyclohexyl)guanidine (PubChem CID 138579998) has the molecular formula C14H25F4N5 and a molecular weight of 339.38 g/mol. Its IUPAC name is 1-[amino-[(4,4-difluorocyclohexyl)amino]methyl]-2-(4,4-difluorocyclohexyl)guanidine.
| Compound Name | 1-[amino-[(4,4-difluorocyclohexyl)amino]methyl]-2-(4,4-difluorocyclohexyl)guanidine |
|---|---|
| PubChem CID | 138579998 |
| Molecular Formula | C14H25F4N5 |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 1-[amino-[(4,4-difluorocyclohexyl)amino]methyl]-2-(4,4-difluorocyclohexyl)guanidine |
| SMILES | N/C(=N\C1CCC(F)(F)CC1)NC(N)NC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H25F4N5/c15-13(16)5-1-9(2-6-13)21-11(19)23-12(20)22-10-3-7-14(17,18)8-4-10/h9-11,21H,1-8,19H2,(H3,20,22,23) |
| InChIKey | ZBZIFZWQMGODNX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|