C15H17FN2O — CID 138580161
(NE)-N-[[6-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-3-fluoro-2-pyridinyl]methylidene]hydroxylamine (PubChem CID 138580161) has the molecular formula C15H17FN2O and a molecular weight of 260.31 g/mol. Its IUPAC name is (NE)-N-[[6-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-3-fluoro-2-pyridinyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[6-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-3-fluoro-2-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 138580161 |
| Molecular Formula | C15H17FN2O |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (NE)-N-[[6-[(3Z,5Z)-3-ethenylhepta-3,5-dienyl]-3-fluoro-2-pyridinyl]methylidene]hydroxylamine |
| SMILES | C=C/C(=C\C=C/C)CCc1ccc(F)c(/C=N/O)n1 |
| InChI | InChI=1S/C15H17FN2O/c1-3-5-6-12(4-2)7-8-13-9-10-14(16)15(18-13)11-17-19/h3-6,9-11,19H,2,7-8H2,1H3/b5-3-,12-6+,17-11+ |
| InChIKey | TVTWUBWILOGUJE-MDVMJZJLSA-N |
| XLogP | 3.65 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|