About 3-tert-butyl-5-ethenyl-2-methyl-1,5-dihydropyrazole
3-tert-butyl-5-ethenyl-2-methyl-1,5-dihydropyrazole (PubChem CID 138580307) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 3-tert-butyl-5-ethenyl-2-methyl-1,5-dihydropyrazole.
Molecular Properties
| Compound Name | 3-tert-butyl-5-ethenyl-2-methyl-1,5-dihydropyrazole |
| PubChem CID | 138580307 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 3-tert-butyl-5-ethenyl-2-methyl-1,5-dihydropyrazole |
| SMILES | C=CC1C=C(C(C)(C)C)N(C)N1 |
| InChI | InChI=1S/C10H18N2/c1-6-8-7-9(10(2,3)4)12(5)11-8/h6-8,11H,1H2,2-5H3 |
| InChIKey | SAODFGZIXWZJAN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-5-ethenyl-2-methyl-1,5-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5-ethenyl-2-methyl-1,5-dihydropyrazole?
The IUPAC name of 3-tert-butyl-5-ethenyl-2-methyl-1,5-dihydropyrazole (CID 138580307) is 3-tert-butyl-5-ethenyl-2-methyl-1,5-dihydropyrazole.
What is the SMILES notation for 3-tert-butyl-5-ethenyl-2-methyl-1,5-dihydropyrazole?
The canonical SMILES for 3-tert-butyl-5-ethenyl-2-methyl-1,5-dihydropyrazole is C=CC1C=C(C(C)(C)C)N(C)N1.
What is the InChIKey of 3-tert-butyl-5-ethenyl-2-methyl-1,5-dihydropyrazole?
The InChIKey is SAODFGZIXWZJAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-6-8-7-9(10(2,3)4)12(5)11-8/h6-8,11H,1H2,2-5H3.
What are the key properties of 3-tert-butyl-5-ethenyl-2-methyl-1,5-dihydropyrazole?
3-tert-butyl-5-ethenyl-2-methyl-1,5-dihydropyrazole has a molecular weight of 166.27 g/mol, XLogP of 1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5-ethenyl-2-methyl-1,5-dihydropyrazole is sourced from PubChem (CID 138580307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).