C24H24N6 — CID 138580554
3,3-dimethyl-5-[2-(1,2,3,4-tetrahydroisoquinolin-8-ylamino)pyrimidin-4-yl]-1,2-dihydroindole-7-carbonitrile (PubChem CID 138580554) has the molecular formula C24H24N6 and a molecular weight of 396.50 g/mol. Its IUPAC name is 3,3-dimethyl-5-[2-(1,2,3,4-tetrahydroisoquinolin-8-ylamino)pyrimidin-4-yl]-1,2-dihydroindole-7-carbonitrile.
| Compound Name | 3,3-dimethyl-5-[2-(1,2,3,4-tetrahydroisoquinolin-8-ylamino)pyrimidin-4-yl]-1,2-dihydroindole-7-carbonitrile |
|---|---|
| PubChem CID | 138580554 |
| Molecular Formula | C24H24N6 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 3,3-dimethyl-5-[2-(1,2,3,4-tetrahydroisoquinolin-8-ylamino)pyrimidin-4-yl]-1,2-dihydroindole-7-carbonitrile |
| SMILES | CC1(C)CNc2c(C#N)cc(-c3ccnc(Nc4cccc5c4CNCC5)n3)cc21 |
| InChI | InChI=1S/C24H24N6/c1-24(2)14-28-22-17(12-25)10-16(11-19(22)24)20-7-9-27-23(29-20)30-21-5-3-4-15-6-8-26-13-18(15)21/h3-5,7,9-11,26,28H,6,8,13-14H2,1-2H3,(H,27,29,30) |
| InChIKey | NGLAFMJKTGPGTE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |