C18H26ClN5O3 — CID 138580711
tert-butyl N-[5-chloro-6-[[(1E,3E)-5-(dimethylamino)-3,4-dimethyl-5-oxopenta-1,3-dienyl]amino]pyrimidin-4-yl]carbamate (PubChem CID 138580711) has the molecular formula C18H26ClN5O3 and a molecular weight of 395.89 g/mol. Its IUPAC name is tert-butyl N-[5-chloro-6-[[(1E,3E)-5-(dimethylamino)-3,4-dimethyl-5-oxopenta-1,3-dienyl]amino]pyrimidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[5-chloro-6-[[(1E,3E)-5-(dimethylamino)-3,4-dimethyl-5-oxopenta-1,3-dienyl]amino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 138580711 |
| Molecular Formula | C18H26ClN5O3 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | tert-butyl N-[5-chloro-6-[[(1E,3E)-5-(dimethylamino)-3,4-dimethyl-5-oxopenta-1,3-dienyl]amino]pyrimidin-4-yl]carbamate |
| SMILES | CC(/C=C/Nc1ncnc(NC(=O)OC(C)(C)C)c1Cl)=C(/C)C(=O)N(C)C |
| InChI | InChI=1S/C18H26ClN5O3/c1-11(12(2)16(25)24(6)7)8-9-20-14-13(19)15(22-10-21-14)23-17(26)27-18(3,4)5/h8-10H,1-7H3,(H2,20,21,22,23,26)/b9-8+,12-11+ |
| InChIKey | IGRLDHIWJKDZFO-MVKOLZDDSA-N |
| XLogP | 3.83 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|