C31H38N6O — CID 138580757
(3R)-3-(hydroxymethyl)-3-methyl-5-[2-[(3-methyl-8-pentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)amino]pyrimidin-4-yl]-1,2-dihydroindole-7-carbonitrile (PubChem CID 138580757) has the molecular formula C31H38N6O and a molecular weight of 510.69 g/mol. Its IUPAC name is (3R)-3-(hydroxymethyl)-3-methyl-5-[2-[(3-methyl-8-pentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)amino]pyrimidin-4-yl]-1,2-dihydroindole-7-carbonitrile.
| Compound Name | (3R)-3-(hydroxymethyl)-3-methyl-5-[2-[(3-methyl-8-pentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)amino]pyrimidin-4-yl]-1,2-dihydroindole-7-carbonitrile |
|---|---|
| PubChem CID | 138580757 |
| Molecular Formula | C31H38N6O |
| Molecular Weight | 510.69 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | (3R)-3-(hydroxymethyl)-3-methyl-5-[2-[(3-methyl-8-pentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)amino]pyrimidin-4-yl]-1,2-dihydroindole-7-carbonitrile |
| SMILES | CCCCCc1cc2c(cc1Nc1nccc(-c3cc(C#N)c4c(c3)[C@@](C)(CO)CN4)n1)CCN(C)CC2 |
| InChI | InChI=1S/C31H38N6O/c1-4-5-6-7-23-14-21-9-12-37(3)13-10-22(21)17-28(23)36-30-33-11-8-27(35-30)24-15-25(18-32)29-26(16-24)31(2,20-38)19-34-29/h8,11,14-17,34,38H,4-7,9-10,12-13,19-20H2,1-3H3,(H,33,35,36)/t31-/m1/s1 |
| InChIKey | KYDSPTKWRGYXDC-WJOKGBTCSA-N |
| XLogP | 5.20 |
| TPSA | 97.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.69 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|