C23H25N7O2 — CID 138580882
5-[2-[(6,6-dimethyl-4,7-dihydropyrazolo[5,1-c][1,4]oxazin-2-yl)amino]pyrimidin-4-yl]-3-(hydroxymethyl)-3-methyl-1,2-dihydroindole-7-carbonitrile (PubChem CID 138580882) has the molecular formula C23H25N7O2 and a molecular weight of 431.50 g/mol. Its IUPAC name is 5-[2-[(6,6-dimethyl-4,7-dihydropyrazolo[5,1-c][1,4]oxazin-2-yl)amino]pyrimidin-4-yl]-3-(hydroxymethyl)-3-methyl-1,2-dihydroindole-7-carbonitrile.
| Compound Name | 5-[2-[(6,6-dimethyl-4,7-dihydropyrazolo[5,1-c][1,4]oxazin-2-yl)amino]pyrimidin-4-yl]-3-(hydroxymethyl)-3-methyl-1,2-dihydroindole-7-carbonitrile |
|---|---|
| PubChem CID | 138580882 |
| Molecular Formula | C23H25N7O2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 5-[2-[(6,6-dimethyl-4,7-dihydropyrazolo[5,1-c][1,4]oxazin-2-yl)amino]pyrimidin-4-yl]-3-(hydroxymethyl)-3-methyl-1,2-dihydroindole-7-carbonitrile |
| SMILES | CC1(C)Cn2nc(Nc3nccc(-c4cc(C#N)c5c(c4)C(C)(CO)CN5)n3)cc2CO1 |
| InChI | InChI=1S/C23H25N7O2/c1-22(2)12-30-16(10-32-22)8-19(29-30)28-21-25-5-4-18(27-21)14-6-15(9-24)20-17(7-14)23(3,13-31)11-26-20/h4-8,26,31H,10-13H2,1-3H3,(H,25,27,28,29) |
| InChIKey | RARXQSHQIZMPIJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |