About 1,3-di(butan-2-yl)-4,5-dimethyl-N-propan-2-ylimidazol-2-imine
1,3-di(butan-2-yl)-4,5-dimethyl-N-propan-2-ylimidazol-2-imine (PubChem CID 138581154) has the molecular formula C16H31N3
and a molecular weight of 265.44 g/mol. Its IUPAC name is 1,3-di(butan-2-yl)-4,5-dimethyl-N-propan-2-ylimidazol-2-imine.
Molecular Properties
| Compound Name | 1,3-di(butan-2-yl)-4,5-dimethyl-N-propan-2-ylimidazol-2-imine |
| PubChem CID | 138581154 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | 1,3-di(butan-2-yl)-4,5-dimethyl-N-propan-2-ylimidazol-2-imine |
| SMILES | CCC(C)n1c(C)c(C)n(C(C)CC)c1=NC(C)C |
| InChI | InChI=1S/C16H31N3/c1-9-12(5)18-14(7)15(8)19(13(6)10-2)16(18)17-11(3)4/h11-13H,9-10H2,1-8H3 |
| InChIKey | ARAQPYCECYNUGT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 22.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-di(butan-2-yl)-4,5-dimethyl-N-propan-2-ylimidazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-di(butan-2-yl)-4,5-dimethyl-N-propan-2-ylimidazol-2-imine?
The IUPAC name of 1,3-di(butan-2-yl)-4,5-dimethyl-N-propan-2-ylimidazol-2-imine (CID 138581154) is 1,3-di(butan-2-yl)-4,5-dimethyl-N-propan-2-ylimidazol-2-imine.
What is the SMILES notation for 1,3-di(butan-2-yl)-4,5-dimethyl-N-propan-2-ylimidazol-2-imine?
The canonical SMILES for 1,3-di(butan-2-yl)-4,5-dimethyl-N-propan-2-ylimidazol-2-imine is CCC(C)n1c(C)c(C)n(C(C)CC)c1=NC(C)C.
What is the InChIKey of 1,3-di(butan-2-yl)-4,5-dimethyl-N-propan-2-ylimidazol-2-imine?
The InChIKey is ARAQPYCECYNUGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N3/c1-9-12(5)18-14(7)15(8)19(13(6)10-2)16(18)17-11(3)4/h11-13H,9-10H2,1-8H3.
What are the key properties of 1,3-di(butan-2-yl)-4,5-dimethyl-N-propan-2-ylimidazol-2-imine?
1,3-di(butan-2-yl)-4,5-dimethyl-N-propan-2-ylimidazol-2-imine has a molecular weight of 265.44 g/mol, XLogP of 4.16, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-di(butan-2-yl)-4,5-dimethyl-N-propan-2-ylimidazol-2-imine is sourced from PubChem (CID 138581154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).