C8H13N — CID 138582724
3,6-dimethyl-3-azabicyclo[3.1.1]hept-1(6)-ene (PubChem CID 138582724) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is 3,6-dimethyl-3-azabicyclo[3.1.1]hept-1(6)-ene.
| Compound Name | 3,6-dimethyl-3-azabicyclo[3.1.1]hept-1(6)-ene |
|---|---|
| PubChem CID | 138582724 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 3,6-dimethyl-3-azabicyclo[3.1.1]hept-1(6)-ene |
| SMILES | CC1=C2CC1CN(C)C2 |
| InChI | InChI=1S/C8H13N/c1-6-7-3-8(6)5-9(2)4-7/h7H,3-5H2,1-2H3 |
| InChIKey | UEXZMVIIXWSZSL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|