C17H22N2O2S2 — CID 1385833
4-[[3-[3-(diethylazaniumyl)propyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenolate (PubChem CID 1385833) has the molecular formula C17H22N2O2S2 and a molecular weight of 350.51 g/mol. Its IUPAC name is 4-[[3-[3-(diethylazaniumyl)propyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenolate.
| Compound Name | 4-[[3-[3-(diethylazaniumyl)propyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenolate |
|---|---|
| PubChem CID | 1385833 |
| Molecular Formula | C17H22N2O2S2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-[[3-[3-(diethylazaniumyl)propyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenolate |
| SMILES | CC[NH+](CC)CCCN1C(=O)C(=Cc2ccc([O-])cc2)SC1=S |
| InChI | InChI=1S/C17H22N2O2S2/c1-3-18(4-2)10-5-11-19-16(21)15(23-17(19)22)12-13-6-8-14(20)9-7-13/h6-9,12,20H,3-5,10-11H2,1-2H3 |
| InChIKey | URJZNQNSMSQOSX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 47.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|