C24H25N3O10 — CID 138583640
(4S,4aS,5aR,12aR)-4-(diformylamino)-1,10,11,12a-tetrahydroxy-7-[[methoxy(methyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 138583640) has the molecular formula C24H25N3O10 and a molecular weight of 515.48 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(diformylamino)-1,10,11,12a-tetrahydroxy-7-[[methoxy(methyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(diformylamino)-1,10,11,12a-tetrahydroxy-7-[[methoxy(methyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 138583640 |
| Molecular Formula | C24H25N3O10 |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(diformylamino)-1,10,11,12a-tetrahydroxy-7-[[methoxy(methyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CON(C)Cc1ccc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C=O)C=O)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C24H25N3O10/c1-26(37-2)7-10-3-4-14(30)16-12(10)5-11-6-13-18(27(8-28)9-29)20(32)17(23(25)35)22(34)24(13,36)21(33)15(11)19(16)31/h3-4,8-9,11,13,18,30-31,34,36H,5-7H2,1-2H3,(H2,25,35)/t11-,13-,18-,24-/m0/s1 |
| InChIKey | INWPGUXTISVSLH-SBAJWEJLSA-N |
| XLogP | -0.99 |
| TPSA | 208.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|