About 1H-pyrazine-3,4-diamine
1H-pyrazine-3,4-diamine (PubChem CID 138583648) has the molecular formula C4H8N4
and a molecular weight of 112.14 g/mol. Its IUPAC name is 1H-pyrazine-3,4-diamine.
Molecular Properties
| Compound Name | 1H-pyrazine-3,4-diamine |
| PubChem CID | 138583648 |
| Molecular Formula | C4H8N4 |
| Molecular Weight | 112.14 g/mol |
| Exact Mass | 112.07 |
| IUPAC Name | 1H-pyrazine-3,4-diamine |
| SMILES | NC1=CNC=CN1N |
| InChI | InChI=1S/C4H8N4/c5-4-3-7-1-2-8(4)6/h1-3,7H,5-6H2 |
| InChIKey | PGNZCMALJFHFHG-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.14 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrazine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazine-3,4-diamine?
The IUPAC name of 1H-pyrazine-3,4-diamine (CID 138583648) is 1H-pyrazine-3,4-diamine.
What is the SMILES notation for 1H-pyrazine-3,4-diamine?
The canonical SMILES for 1H-pyrazine-3,4-diamine is NC1=CNC=CN1N.
What is the InChIKey of 1H-pyrazine-3,4-diamine?
The InChIKey is PGNZCMALJFHFHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4/c5-4-3-7-1-2-8(4)6/h1-3,7H,5-6H2.
What are the key properties of 1H-pyrazine-3,4-diamine?
1H-pyrazine-3,4-diamine has a molecular weight of 112.14 g/mol, XLogP of -1.01, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazine-3,4-diamine is sourced from PubChem (CID 138583648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).