C23H17F3N6O2 — CID 138583691
2-N-[7-(2,6-difluoro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]-3-fluorobenzene-1,2-diamine (PubChem CID 138583691) has the molecular formula C23H17F3N6O2 and a molecular weight of 466.42 g/mol. Its IUPAC name is 2-N-[7-(2,6-difluoro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]-3-fluorobenzene-1,2-diamine.
| Compound Name | 2-N-[7-(2,6-difluoro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]-3-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 138583691 |
| Molecular Formula | C23H17F3N6O2 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2-N-[7-(2,6-difluoro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]-3-fluorobenzene-1,2-diamine |
| SMILES | COc1cc(OC)c(F)c(-c2cc3cnc(Nc4c(N)cccc4F)nc3n3ccnc23)c1F |
| InChI | InChI=1S/C23H17F3N6O2/c1-33-15-9-16(34-2)19(26)17(18(15)25)12-8-11-10-29-23(30-20-13(24)4-3-5-14(20)27)31-21(11)32-7-6-28-22(12)32/h3-10H,27H2,1-2H3,(H,29,30,31) |
| InChIKey | UGJWIEQFZGOJBD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|