C25H24Cl2N6O4 — CID 138583775
N-[(3S,4S)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]oxan-4-yl]prop-2-enamide (PubChem CID 138583775) has the molecular formula C25H24Cl2N6O4 and a molecular weight of 543.41 g/mol. Its IUPAC name is N-[(3S,4S)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]oxan-4-yl]prop-2-enamide.
| Compound Name | N-[(3S,4S)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]oxan-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 138583775 |
| Molecular Formula | C25H24Cl2N6O4 |
| Molecular Weight | 543.41 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | N-[(3S,4S)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]oxan-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCOC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)c3nccn3c2n1 |
| InChI | InChI=1S/C25H24Cl2N6O4/c1-4-19(34)30-15-5-8-37-12-16(15)31-25-29-11-13-9-14(24-28-6-7-33(24)23(13)32-25)20-21(26)17(35-2)10-18(36-3)22(20)27/h4,6-7,9-11,15-16H,1,5,8,12H2,2-3H3,(H,30,34)(H,29,31,32)/t15-,16+/m0/s1 |
| InChIKey | DNWTXGLFAOCMTL-JKSUJKDBSA-N |
| XLogP | 4.14 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|