C27H26ClF3N2O4 — CID 138583969
3-[4-[[[3-chloro-5-methyl-4-[2-(trifluoromethoxy)phenyl]phenyl]carbamoylamino]methyl]phenyl]propyl acetate (PubChem CID 138583969) has the molecular formula C27H26ClF3N2O4 and a molecular weight of 534.96 g/mol. Its IUPAC name is 3-[4-[[[3-chloro-5-methyl-4-[2-(trifluoromethoxy)phenyl]phenyl]carbamoylamino]methyl]phenyl]propyl acetate.
| Compound Name | 3-[4-[[[3-chloro-5-methyl-4-[2-(trifluoromethoxy)phenyl]phenyl]carbamoylamino]methyl]phenyl]propyl acetate |
|---|---|
| PubChem CID | 138583969 |
| Molecular Formula | C27H26ClF3N2O4 |
| Molecular Weight | 534.96 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 3-[4-[[[3-chloro-5-methyl-4-[2-(trifluoromethoxy)phenyl]phenyl]carbamoylamino]methyl]phenyl]propyl acetate |
| SMILES | CC(=O)OCCCc1ccc(CNC(=O)Nc2cc(C)c(-c3ccccc3OC(F)(F)F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C27H26ClF3N2O4/c1-17-14-21(15-23(28)25(17)22-7-3-4-8-24(22)37-27(29,30)31)33-26(35)32-16-20-11-9-19(10-12-20)6-5-13-36-18(2)34/h3-4,7-12,14-15H,5-6,13,16H2,1-2H3,(H2,32,33,35) |
| InChIKey | SOAPBDMFQNFWDR-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.96 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|