C9H6N4 — CID 138584151
2,4,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8,10,12-hexaene (PubChem CID 138584151) has the molecular formula C9H6N4 and a molecular weight of 170.18 g/mol. Its IUPAC name is 2,4,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8,10,12-hexaene.
| Compound Name | 2,4,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8,10,12-hexaene |
|---|---|
| PubChem CID | 138584151 |
| Molecular Formula | C9H6N4 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 2,4,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8,10,12-hexaene |
| SMILES | c1cc2nc3nccn3cc2cn1 |
| InChI | InChI=1S/C9H6N4/c1-2-10-5-7-6-13-4-3-11-9(13)12-8(1)7/h1-6H |
| InChIKey | FPEZJNXVLHZKRE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |