About 1-O-benzyl 4-O-tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperazine-1,4-dicarboxylate
1-O-benzyl 4-O-tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperazine-1,4-dicarboxylate (PubChem CID 138584276) has the molecular formula C24H27F3N4O5
and a molecular weight of 508.50 g/mol. Its IUPAC name is 1-O-benzyl 4-O-tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperazine-1,4-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-benzyl 4-O-tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperazine-1,4-dicarboxylate |
| PubChem CID | 138584276 |
| Molecular Formula | C24H27F3N4O5 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 1-O-benzyl 4-O-tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperazine-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OCc2ccccc2)C(C(=O)Nc2cccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C24H27F3N4O5/c1-23(2,3)36-21(33)30-12-13-31(22(34)35-15-16-8-5-4-6-9-16)17(14-30)20(32)29-19-11-7-10-18(28-19)24(25,26)27/h4-11,17H,12-15H2,1-3H3,(H,28,29,32) |
| InChIKey | YRIDRVXJSCSQHE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-O-benzyl 4-O-tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperazine-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-benzyl 4-O-tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperazine-1,4-dicarboxylate?
The IUPAC name of 1-O-benzyl 4-O-tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperazine-1,4-dicarboxylate (CID 138584276) is 1-O-benzyl 4-O-tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperazine-1,4-dicarboxylate.
What is the SMILES notation for 1-O-benzyl 4-O-tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperazine-1,4-dicarboxylate?
The canonical SMILES for 1-O-benzyl 4-O-tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperazine-1,4-dicarboxylate is CC(C)(C)OC(=O)N1CCN(C(=O)OCc2ccccc2)C(C(=O)Nc2cccc(C(F)(F)F)n2)C1.
What is the InChIKey of 1-O-benzyl 4-O-tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperazine-1,4-dicarboxylate?
The InChIKey is YRIDRVXJSCSQHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27F3N4O5/c1-23(2,3)36-21(33)30-12-13-31(22(34)35-15-16-8-5-4-6-9-16)17(14-30)20(32)29-19-11-7-10-18(28-19)24(25,26)27/h4-11,17H,12-15H2,1-3H3,(H,28,29,32).
What are the key properties of 1-O-benzyl 4-O-tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperazine-1,4-dicarboxylate?
1-O-benzyl 4-O-tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperazine-1,4-dicarboxylate has a molecular weight of 508.50 g/mol, XLogP of 4.30, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-benzyl 4-O-tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperazine-1,4-dicarboxylate is sourced from PubChem (CID 138584276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).